ChemNet > CAS > 602-87-9 5-Nitroacenaphthene
602-87-9 5-Nitroacenaphthene
| उत्पाद का नाम |
5-Nitroacenaphthene |
| समानार्थी |
1,2-Dihydro-5-nitro-acenaphthylene; 4-05-00-01840 (Beilstein Handbook Reference); 5-Nan; 5-Nitroacenaphthylene; 5-Nitroacenapthene; 5-Nitronaphthalene; 5-Nitronaphthalene ethylene; Acenaphthene, 5-nitro-; Acenaphthylene, 1,2-dihydro-5-nitro-; BRN 1876864; CCRIS 438; HSDB 4092; NCI-C01967; NSC 1312; NSC 22421; 1,2-Dihydro-5-nitroacenaphthylene; 5-nitro-1,2-dihydroacenaphthylene; Nitroacenaphthene; 1,2-dihydro-5-nitro-acenaphthylen |
| आणविक फार्मूला |
C12H7NO2 |
| आण्विक वजन |
197.1895 |
| InChI |
InChI=1/C12H7NO2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-7H |
| कैस रजिस्टी संख्या |
602-87-9 |
| EINECS |
210-025-0 |
| आणविक संरचना |
|
| घनत्व |
1.408g/cm3 |
| गलनांक |
101-102℃ |
| उबलने का समय |
381.6°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.763 |
| फ्लैश प्वाइंट |
196.7°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R45:May cause cancer.;
|
| सुरक्षा विवरण |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
