ChemNet > CAS > 61341-26-2 3-Methylthiophene-2-carbonyl chloride
61341-26-2 3-Methylthiophene-2-carbonyl chloride
उत्पाद का नाम |
3-Methylthiophene-2-carbonyl chloride |
समानार्थी |
2-thiophenecarbonyl chloride, 3-methyl-; 3-METHYLTHIOPHENE-2-CARBONYL CHLORIDE |
आणविक फार्मूला |
C6H5ClOS |
आण्विक वजन |
160.6213 |
InChI |
InChI=1/C6H5ClOS/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3 |
कैस रजिस्टी संख्या |
61341-26-2 |
आणविक संरचना |
|
घनत्व |
1.32g/cm3 |
उबलने का समय |
219.9°C at 760 mmHg |
अपवर्तक सूचकांक |
1.566 |
फ्लैश प्वाइंट |
86.8°C |
खतरा प्रतीक |
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|