ChemNet > CAS > 6396-76-5 1-(2,6-Dimethylphenyl)-thiourea
6396-76-5 1-(2,6-Dimethylphenyl)-thiourea
उत्पाद का नाम |
1-(2,6-Dimethylphenyl)-thiourea |
अंग्रेजी नाम |
1-(2,6-Dimethylphenyl)-thiourea; 2,6-Dimethylphenylthiourea |
आणविक फार्मूला |
C9H12N2S |
आण्विक वजन |
180.27 |
InChI |
InChI=1/C9H12N2S/c1-6-4-3-5-7(2)8(6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
कैस रजिस्टी संख्या |
6396-76-5 |
EINECS |
229-005-8 |
आणविक संरचना |
|
घनत्व |
1.2g/cm3 |
उबलने का समय |
284.4°C at 760 mmHg |
अपवर्तक सूचकांक |
1.674 |
फ्लैश प्वाइंट |
125.8°C |
वाष्प का दबाव |
0.00298mmHg at 25°C |
खतरे के कोड |
R25:Toxic if swallowed.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|