ChemNet > CAS > 84540-59-0 4-Methyl-3-nitrobenzyl chloride
84540-59-0 4-Methyl-3-nitrobenzyl chloride
उत्पाद का नाम |
4-Methyl-3-nitrobenzyl chloride |
समानार्थी |
4-(Chloromethyl)-2-nitrotoluene; 4-(chloromethyl)-1-methyl-2-nitrobenzene |
आणविक फार्मूला |
C8H8ClNO2 |
आण्विक वजन |
185.6076 |
InChI |
InChI=1/C8H8ClNO2/c1-6-2-3-7(5-9)4-8(6)10(11)12/h2-4H,5H2,1H3 |
कैस रजिस्टी संख्या |
84540-59-0 |
EINECS |
283-154-3 |
आणविक संरचना |
|
घनत्व |
1.277g/cm3 |
गलनांक |
46-50℃ |
उबलने का समय |
336.5°C at 760 mmHg |
अपवर्तक सूचकांक |
1.566 |
फ्लैश प्वाइंट |
133.3°C |
खतरा प्रतीक |
C:Corrosive;
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|