ChemNet > CAS > 85199-06-0 2,5-Dimethylbenzeneboronic acid
85199-06-0 2,5-Dimethylbenzeneboronic acid
| उत्पाद का नाम |
2,5-Dimethylbenzeneboronic acid |
| समानार्थी |
2,5-Dimethylphenylboronic acid; P-XYLENE-2-BORONIC ACID |
| आणविक फार्मूला |
C8H11BO2 |
| आण्विक वजन |
149.9827 |
| InChI |
InChI=1/C8H11BO2/c1-6-3-4-7(2)8(5-6)9(10)11/h3-5,10-11H,1-2H3 |
| कैस रजिस्टी संख्या |
85199-06-0 |
| आणविक संरचना |
|
| घनत्व |
1.07g/cm3 |
| गलनांक |
186-191℃ |
| उबलने का समय |
305.1°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.523 |
| फ्लैश प्वाइंट |
138.3°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
