ChemNet > CAS > 9009-54-5 Polyurethane
9009-54-5 Polyurethane
| उत्पाद का नाम |
Polyurethane |
| समानार्थी |
Polyurethane foam; Polyurethane foams; Polyisocyanurate resins; Polyurethanes, cellular; PU foam; The following companies react isocyanates or prepolymers with polyols to produce polyurethane foams. The list is incomplete.; POLYURETHANEOLIGOMERS; POLYURETHANEVARNISH; PU; Acrylic polyurethane paint; Acrylic polyurethane anticorrosive coating; Polyurethane mixed component; 1-ethylurea |
| आणविक फार्मूला |
C3H8N2O |
| आण्विक वजन |
88.1084 |
| InChI |
InChI=1/C3H8N2O/c1-2-5-3(4)6/h2H2,1H3,(H3,4,5,6) |
| कैस रजिस्टी संख्या |
9009-54-5 |
| EINECS |
210-898-8 |
| आणविक संरचना |
|
| घनत्व |
1.005g/cm3 |
| उबलने का समय |
136.3°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.44 |
| फ्लैश प्वाइंट |
36.2°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
|
|
