927-67-3 n-Propylthiourea
उत्पाद का नाम |
n-Propylthiourea |
अंग्रेजी नाम |
n-Propylthiourea;Propyl-2-thiourea; Propylthiourea; Thiourea, propyl-; 1-propylthiourea |
आणविक फार्मूला |
C4H10N2S |
आण्विक वजन |
118.2006 |
InChI |
InChI=1/C4H10N2S/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7) |
कैस रजिस्टी संख्या |
927-67-3 |
EINECS |
213-158-2 |
आणविक संरचना |
|
घनत्व |
1.054g/cm3 |
उबलने का समय |
182.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.537 |
फ्लैश प्वाइंट |
63.9°C |
वाष्प का दबाव |
0.825mmHg at 25°C |
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|