ChemNet > CAS > 13191-36-1 2,5-Dibromo-3-methylthiophene
13191-36-1 2,5-Dibromo-3-methylthiophene
نام محصول |
2,5-Dibromo-3-methylthiophene |
نام انگلیسی |
2,5-Dibromo-3-methylthiophene; |
میدان مغناطیسی |
C5H4Br2S |
وزن مولکولی |
255.9583 |
InChI |
InChI=1/C5H4Br2S/c1-3-2-4(6)8-5(3)7/h2H,1H3 |
شماره سیایاس |
13191-36-1 |
تعداد کمیسیون اروپایی |
236-147-4 |
ساختار مولکولی |
|
تراکم |
2.006g/cm3 |
نقطه غلیان |
230.2°C at 760 mmHg |
ضریب شکست |
1.62 |
نقطه اشتعال |
93°C |
فشار بخار |
0.101mmHg at 25°C |
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|