ChemNet > CAS > 14109-72-9 1-Methylthio-2-propanone
14109-72-9 1-Methylthio-2-propanone
نام محصول |
1-Methylthio-2-propanone |
مترادف |
1-(Methylsulfanyl)acetone; 1-(methylthio)acetone; 1-METHYLTHIO-2-PROPANONE; 2-propanone, 1-(methylthio)-; 1-(methylsulfanyl)propan-2-one; 1-Methylthio propanone |
میدان مغناطیسی |
C4H8OS |
وزن مولکولی |
104.1707 |
InChI |
InChI=1/C4H8OS/c1-4(5)3-6-2/h3H2,1-2H3 |
شماره سیایاس |
14109-72-9 |
ساختار مولکولی |
|
تراکم |
0.985g/cm3 |
نقطه غلیان |
144°C at 760 mmHg |
ضریب شکست |
1.453 |
نقطه اشتعال |
42.8°C |
خطر نمادها |
|
کدهای خطر |
R10:Flammable.;
|
توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|