14979-39-6 4-Methyl-3-heptanol
نام محصول |
4-Methyl-3-heptanol |
نام انگلیسی |
4-Methyl-3-heptanol; 4-Methyl-3-heptanol,mixture of isomers; Ethyl 2-pentyl carbinol; 4-methylheptan-3-ol; (3R,4S)-4-methylheptan-3-ol; (3S,4S)-4-methylheptan-3-ol; (3R,4R)-4-methylheptan-3-ol; (3S,4R)-4-methylheptan-3-ol |
میدان مغناطیسی |
C8H18O |
وزن مولکولی |
130.2279 |
InChI |
InChI=1/C8H18O/c1-4-6-7(3)8(9)5-2/h7-9H,4-6H2,1-3H3/t7-,8+/m1/s1 |
شماره سیایاس |
14979-39-6 |
تعداد کمیسیون اروپایی |
239-058-9 |
ساختار مولکولی |
|
تراکم |
0.819g/cm3 |
نقطه غلیان |
158.5°C at 760 mmHg |
ضریب شکست |
1.424 |
نقطه اشتعال |
54.4°C |
فشار بخار |
0.927mmHg at 25°C |
کدهای خطر |
R10:Flammable.;
|
توضیحات ایمنی |
S16:Keep away from sources of ignition - No smoking.;
|
|