ChemNet > CAS > 151411-98-2 2,4,6-Trifluorobenzyl bromide
151411-98-2 2,4,6-Trifluorobenzyl bromide
نام محصول |
2,4,6-Trifluorobenzyl bromide |
مترادف |
alpha-Bromo-2,4,6-trifluorotoluene; 2-(bromomethyl)-1,3,5-trifluorobenzene |
میدان مغناطیسی |
C7H4BrF3 |
وزن مولکولی |
225.0059 |
InChI |
InChI=1/C7H4BrF3/c8-3-5-6(10)1-4(9)2-7(5)11/h1-2H,3H2 |
شماره سیایاس |
151411-98-2 |
ساختار مولکولی |
|
تراکم |
1.71g/cm3 |
نقطه غلیان |
177.4°C at 760 mmHg |
ضریب شکست |
1.502 |
نقطه اشتعال |
66.1°C |
خطر نمادها |
|
کدهای خطر |
R34:Causes burns.;
R36:Irritating to eyes.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|