1517-66-4 (+)-3-Methyl-2-butanol
نام محصول |
(+)-3-Methyl-2-butanol |
نام انگلیسی |
(+)-3-Methyl-2-butanol; (S)-(+)-3-Methyl-2-butanol; (S)-(+)-Isopropyl methyl carbinol; 3-methylbutan-2-ol; (2S)-3-methylbutan-2-ol |
میدان مغناطیسی |
C5H12O |
وزن مولکولی |
88.1482 |
InChI |
InChI=1/C5H12O/c1-4(2)5(3)6/h4-6H,1-3H3/t5-/m0/s1 |
شماره سیایاس |
1517-66-4 |
تعداد کمیسیون اروپایی |
209-950-2 |
ساختار مولکولی |
|
تراکم |
0.806g/cm3 |
نقطه غلیان |
113.6°C at 760 mmHg |
ضریب شکست |
1.402 |
نقطه اشتعال |
26.7°C |
فشار بخار |
10.6mmHg at 25°C |
کدهای خطر |
R10:Flammable.;
R20:Harmful by inhalation.;
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|