ChemNet > CAS > 1552-94-9 (2E,4E)-5-phenylpenta-2,4-dienoic acid
1552-94-9 (2E,4E)-5-phenylpenta-2,4-dienoic acid
نام محصول |
(2E,4E)-5-phenylpenta-2,4-dienoic acid |
نام انگلیسی |
(2E,4E)-5-phenylpenta-2,4-dienoic acid; Cinnamalacetic acid; 5-phenylpenta-2,4-dienoic acid |
میدان مغناطیسی |
C11H10O2 |
وزن مولکولی |
174.1959 |
InChI |
InChI=1/C11H10O2/c12-11(13)9-5-4-8-10-6-2-1-3-7-10/h1-9H,(H,12,13)/b8-4+,9-5+ |
شماره سیایاس |
1552-94-9 |
تعداد کمیسیون اروپایی |
216-298-2 |
ساختار مولکولی |
|
تراکم |
1.148g/cm3 |
نقطه غلیان |
356.1°C at 760 mmHg |
ضریب شکست |
1.616 |
نقطه اشتعال |
257.6°C |
فشار بخار |
1.09E-05mmHg at 25°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|