ChemNet > CAS > 162101-31-7 2-Fluoro-4-methoxybenzeneboronic acid
162101-31-7 2-Fluoro-4-methoxybenzeneboronic acid
نام محصول |
2-Fluoro-4-methoxybenzeneboronic acid |
نام انگلیسی |
2-Fluoro-4-methoxybenzeneboronic acid; 2-Fluoro-4-methoxyphenylboronic acid; Fluoro-4-methoxyphenylboronic acid |
میدان مغناطیسی |
C7H8BFO3 |
وزن مولکولی |
169.946 |
InChI |
InChI=1/C7H8BFO3/c1-12-5-2-3-6(8(10)11)7(9)4-5/h2-4,10-11H,1H3 |
شماره سیایاس |
162101-31-7 |
ساختار مولکولی |
|
تراکم |
1.265g/cm3 |
نقطه غلیان |
291.169°C at 760 mmHg |
ضریب شکست |
1.504 |
نقطه اشتعال |
129.895°C |
فشار بخار |
0.001mmHg at 25°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|