1732-08-7 Dimethyl pimelate
نام محصول |
Dimethyl pimelate |
نام انگلیسی |
Dimethyl pimelate; Dimethyl 1,7-Heptanedioate; Heptanedioic acid dimethyl ester; Pimelic acid dimethyl ester; dimethyl heptanedioate |
میدان مغناطیسی |
C9H16O4 |
وزن مولکولی |
188.2209 |
InChI |
InChI=1/C9H16O4/c1-12-8(10)6-4-3-5-7-9(11)13-2/h3-7H2,1-2H3 |
شماره سیایاس |
1732-08-7 |
تعداد کمیسیون اروپایی |
217-057-4 |
ساختار مولکولی |
|
تراکم |
1.022g/cm3 |
نقطه غلیان |
250.3°C at 760 mmHg |
ضریب شکست |
1.427 |
نقطه اشتعال |
105.4°C |
فشار بخار |
0.0219mmHg at 25°C |
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|