ChemNet > CAS > 19337-97-4 trans-3-(3-pyridyl)acrylic acid
19337-97-4 trans-3-(3-pyridyl)acrylic acid
نام محصول |
trans-3-(3-pyridyl)acrylic acid |
مترادف |
3-(3-Pyridine)acrylic acid; (E)-3-(3-pyridinyl)acrylic acid |
میدان مغناطیسی |
C8H7NO2 |
وزن مولکولی |
149.14 |
InChI |
InChI=1/C8H7NO2/c10-8(11)4-3-7-2-1-5-9-6-7/h1-6H,(H,10,11)/b4-3+ |
شماره سیایاس |
19337-97-4 |
ساختار مولکولی |
|
نقطه ذوب |
232-235℃ |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|