ChemNet > CAS > 19788-49-9 Mercaptopropionicacidethylester
19788-49-9 Mercaptopropionicacidethylester
نام محصول |
Mercaptopropionicacidethylester |
مترادف |
2-Mercaptopropionic acid ethyl ester; Ethyl thiolactate~2-Mercaptopropionic acid ethyl ester; ethyl 2-sulfanylpropanoate; Ethyl 2-mercaptopropionate |
میدان مغناطیسی |
C5H10O2S |
وزن مولکولی |
134.1967 |
InChI |
InChI=1/C5H10O2S/c1-3-7-5(6)4(2)8/h4,8H,3H2,1-2H3 |
شماره سیایاس |
19788-49-9 |
تعداد کمیسیون اروپایی |
243-314-5 |
ساختار مولکولی |
|
تراکم |
1.04g/cm3 |
نقطه غلیان |
171.7°C at 760 mmHg |
ضریب شکست |
1.452 |
نقطه اشتعال |
57.4°C |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|