ChemNet > CAS > 205526-37-0 (R)-N-FMOC-3-Cyanophenylalanine
205526-37-0 (R)-N-FMOC-3-Cyanophenylalanine
نام محصول |
(R)-N-FMOC-3-Cyanophenylalanine |
مترادف |
Fmoc-D-3-Cyanophenylalanine; Fmoc-3-Cyano-D-phenylalanine; Fmoc-D-Phe(3-CN)-OH |
میدان مغناطیسی |
C25H19N2O4 |
وزن مولکولی |
411.4299 |
InChI |
InChI=1/C25H20N2O4/c26-14-17-7-5-6-16(12-17)13-23(24(28)29)27-25(30)31-15-22-20-10-3-1-8-18(20)19-9-2-4-11-21(19)22/h1-12,22-23H,13,15H2,(H,27,30)(H,28,29)/p-1/t23-/m1/s1 |
شماره سیایاس |
205526-37-0 |
ساختار مولکولی |
|
نقطه غلیان |
670.7°C at 760 mmHg |
نقطه اشتعال |
359.5°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S37/39:Wear suitable gloves and eye/face protection.;
|
|