ChemNet > CAS > 208173-21-1 4-fluoro-2-(trifluoromethyl)acetophenone
208173-21-1 4-fluoro-2-(trifluoromethyl)acetophenone
نام محصول |
4-fluoro-2-(trifluoromethyl)acetophenone |
نام انگلیسی |
4-fluoro-2-(trifluoromethyl)acetophenone; 4'-fluoro-2'-(trifluoromethyl)acetophenone; 1-[4-fluoro-2-(trifluoromethyl)phenyl]ethanone; 4'-Fluoro-2'-trifluoromethylacetophenone; 4-Fluoro-2-trifluoromethylacetophenone |
میدان مغناطیسی |
C9H9FO2 |
وزن مولکولی |
168.165 |
InChI |
InChI=1/C9H9FO2/c1-6(11)7-3-4-8(10)9(5-7)12-2/h3-5H,1-2H3 |
شماره سیایاس |
208173-21-1 |
ساختار مولکولی |
|
تراکم |
1.127g/cm3 |
نقطه غلیان |
246°C at 760 mmHg |
ضریب شکست |
1.487 |
نقطه اشتعال |
99.6°C |
فشار بخار |
0.0279mmHg at 25°C |
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|