ChemNet > CAS > 216393-64-5 4-Bromo-2-fluorobenzeneboronic acid
216393-64-5 4-Bromo-2-fluorobenzeneboronic acid
| نام محصول |
4-Bromo-2-fluorobenzeneboronic acid |
| نام انگلیسی |
4-Bromo-2-fluorobenzeneboronic acid; 4-Bromo-2-fluorophenylboronic acid |
| میدان مغناطیسی |
C6H5BBrFO2 |
| وزن مولکولی |
218.8161 |
| InChI |
InChI=1/C6H5BBrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
| شماره سیایاس |
216393-64-5 |
| ساختار مولکولی |
|
| تراکم |
1.75g/cm3 |
| نقطه غلیان |
310.6°C at 760 mmHg |
| ضریب شکست |
1.571 |
| نقطه اشتعال |
141.6°C |
| فشار بخار |
0.000255mmHg at 25°C |
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|