ChemNet > CAS > 216393-64-5 4-Bromo-2-fluorobenzeneboronic acid
216393-64-5 4-Bromo-2-fluorobenzeneboronic acid
نام محصول |
4-Bromo-2-fluorobenzeneboronic acid |
مترادف |
4-Bromo-2-fluorophenylboronic acid |
میدان مغناطیسی |
C6H5BBrFO2 |
وزن مولکولی |
218.8161 |
InChI |
InChI=1/C6H5BBrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
شماره سیایاس |
216393-64-5 |
ساختار مولکولی |
|
تراکم |
1.75g/cm3 |
نقطه غلیان |
310.6°C at 760 mmHg |
ضریب شکست |
1.571 |
نقطه اشتعال |
141.6°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|