ChemNet > CAS > 22237-12-3 (3-Amino-4-methylphenyl)boronic acid, hydrochloride
22237-12-3 (3-Amino-4-methylphenyl)boronic acid, hydrochloride
| نام محصول |
(3-Amino-4-methylphenyl)boronic acid, hydrochloride |
| مترادف |
3-Amino-4-methylphenylboronic acid~3-Amino-p-tolylboronic acid; 3-Amino-4-methylbenzeneboronic acid; 5-(dihydroxyboranyl)-2-methylanilinium chloride; (3-amino-4-methylphenyl)boronic acid; 3-Amino-4-Methylphenylboronic Acid Hydrochloride |
| میدان مغناطیسی |
C7H10BNO2 |
| وزن مولکولی |
150.9708 |
| InChI |
InChI=1/C7H10BNO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4,10-11H,9H2,1H3 |
| شماره سیایاس |
22237-12-3 |
| ساختار مولکولی |
|
| تراکم |
1.19g/cm3 |
| نقطه غلیان |
367.6°C at 760 mmHg |
| ضریب شکست |
1.569 |
| نقطه اشتعال |
176.1°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
