ChemNet > CAS > 23351-07-7 1-(4-Cyanophenyl)-pyrrole
23351-07-7 1-(4-Cyanophenyl)-pyrrole
نام محصول |
1-(4-Cyanophenyl)-pyrrole |
نام انگلیسی |
1-(4-Cyanophenyl)-pyrrole; 4-(1H-Pyrrol-1-yl)benzonitrile |
میدان مغناطیسی |
C11H8N2 |
وزن مولکولی |
168.1946 |
InChI |
InChI=1/C11H8N2/c12-9-10-3-5-11(6-4-10)13-7-1-2-8-13/h1-8H |
شماره سیایاس |
23351-07-7 |
ساختار مولکولی |
|
تراکم |
1.05g/cm3 |
نقطه غلیان |
312.8°C at 760 mmHg |
ضریب شکست |
1.589 |
نقطه اشتعال |
143°C |
فشار بخار |
0.000518mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|