ChemNet > CAS > 245536-50-9 2,3-Difluoro-4-methylbenzaldehyde
245536-50-9 2,3-Difluoro-4-methylbenzaldehyde
نام محصول |
2,3-Difluoro-4-methylbenzaldehyde |
نام انگلیسی |
2,3-Difluoro-4-methylbenzaldehyde; 2,3-Difluoro-p-tolualdehyde |
میدان مغناطیسی |
C8H6F2O |
وزن مولکولی |
156.1294 |
InChI |
InChI=1/C8H6F2O/c1-5-2-3-6(4-11)8(10)7(5)9/h2-4H,1H3 |
شماره سیایاس |
245536-50-9 |
ساختار مولکولی |
|
تراکم |
1.241g/cm3 |
نقطه غلیان |
204.2°C at 760 mmHg |
ضریب شکست |
1.513 |
نقطه اشتعال |
76.1°C |
فشار بخار |
0.267mmHg at 25°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|