ChemNet > CAS > 25569-53-3 Poly(ethylene succinate)
25569-53-3 Poly(ethylene succinate)
نام محصول |
Poly(ethylene succinate) |
نام انگلیسی |
Poly(ethylene succinate); Ethylene glycol succinate; ethane-1,2-diol-butanedioic acid (1:1) |
میدان مغناطیسی |
C6H12O6 |
وزن مولکولی |
180.1559 |
InChI |
InChI=1/C4H6O4.C2H6O2/c5-3(6)1-2-4(7)8;3-1-2-4/h1-2H2,(H,5,6)(H,7,8);3-4H,1-2H2 |
شماره سیایاس |
25569-53-3 |
ساختار مولکولی |
|
نقطه ذوب |
69-72℃ |
نقطه غلیان |
236.1°C at 760 mmHg |
نقطه اشتعال |
110.9°C |
فشار بخار |
0.0165mmHg at 25°C |
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|