ChemNet > CAS > 2976-74-1 2,3-Dichlorophenoxyacetic acid
2976-74-1 2,3-Dichlorophenoxyacetic acid
نام محصول |
2,3-Dichlorophenoxyacetic acid |
مترادف |
NSC 74462; Acetic acid, (2,3-dichlorophenoxy)- (8CI)(9CI); (2,3-dichlorophenoxy)acetate; 2-(2,3-Dichlorophenoxy)acetic acid |
میدان مغناطیسی |
C8H5Cl2O3 |
وزن مولکولی |
220.03 |
InChI |
InChI=1/C8H6Cl2O3/c9-5-2-1-3-6(8(5)10)13-4-7(11)12/h1-3H,4H2,(H,11,12)/p-1 |
شماره سیایاس |
2976-74-1 |
تعداد کمیسیون اروپایی |
221-022-9 |
ساختار مولکولی |
|
نقطه ذوب |
172-175℃ |
نقطه غلیان |
348.4°C at 760 mmHg |
نقطه اشتعال |
164.5°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|