ChemNet > CAS > 2981-10-4 1-(1-Piperidino)cyclohexene
2981-10-4 1-(1-Piperidino)cyclohexene
نام محصول |
1-(1-Piperidino)cyclohexene |
مترادف |
1-(Cyclohexen-1-yl)piperidine; 1-(cyclohex-1-en-1-yl)piperidine; 1-Piperidino-1-cyclohexene |
میدان مغناطیسی |
C11H19N |
وزن مولکولی |
165.2753 |
InChI |
InChI=1/C11H19N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h7H,1-6,8-10H2 |
شماره سیایاس |
2981-10-4 |
ساختار مولکولی |
|
تراکم |
0.978g/cm3 |
نقطه غلیان |
262.2°C at 760 mmHg |
ضریب شکست |
1.527 |
نقطه اشتعال |
102.8°C |
خطر نمادها |
|
کدهای خطر |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|