ChemNet > CAS > 33070-32-5 5-bromo-2,2-difluorobenzodioxole
33070-32-5 5-bromo-2,2-difluorobenzodioxole
| نام محصول |
5-bromo-2,2-difluorobenzodioxole |
| نام انگلیسی |
5-bromo-2,2-difluorobenzodioxole; 4-Bromo-1,2-[(difluoromethylene)dioxy]benzene; 3,4-[(Difluoromethylene)dioxy]bromobenzene; 5-bromo-2,2-difluorobenzo[d][1,3]dioxole; 5-bromo-2,2-difluoro-1,3-benzodioxole; 4-fluoro-N-phenylaniline; 5-bromo-2,2-difluoro-2H-1,3-benzodioxole; 5-Bromo-2,2-difluoro-benz[1,3]dioxole |
| میدان مغناطیسی |
C12H10FN |
| وزن مولکولی |
187.2129 |
| InChI |
InChI=1/C12H10FN/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9,14H |
| شماره سیایاس |
33070-32-5 |
| ساختار مولکولی |
|
| تراکم |
1.172g/cm3 |
| نقطه غلیان |
292.1°C at 760 mmHg |
| ضریب شکست |
1.613 |
| نقطه اشتعال |
130.5°C |
| فشار بخار |
0.00187mmHg at 25°C |
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|