ChemNet > CAS > 33577-16-1 Methyl methylsulfinylmethyl sulfide
33577-16-1 Methyl methylsulfinylmethyl sulfide
| نام محصول |
Methyl methylsulfinylmethyl sulfide |
| مترادف |
Methyl (methylthio)methyl sulphoxide; MMTS; Formaldehyde dimethyl thioacetal monoxide; Methyl (methylsulphinyl)methyl sulphide; (methylsulfanyl)(methylsulfinyl)methane; (methylsulfanyl)[(R)-methylsulfinyl]methane; (methylsulfanyl)[(S)-methylsulfinyl]methane |
| میدان مغناطیسی |
C3H8OS2 |
| وزن مولکولی |
124.225 |
| InChI |
InChI=1/C3H8OS2/c1-5-3-6(2)4/h3H2,1-2H3/t6-/m0/s1 |
| شماره سیایاس |
33577-16-1 |
| تعداد کمیسیون اروپایی |
251-577-2 |
| ساختار مولکولی |
|
| تراکم |
1.223g/cm3 |
| نقطه ذوب |
222-226℃ |
| نقطه غلیان |
257.772°C at 760 mmHg |
| ضریب شکست |
1.56 |
| نقطه اشتعال |
121.4°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
