ChemNet > CAS > 337508-71-1 2,3-dihydro-1,4-benzodioxine-6-carbothioamide
337508-71-1 2,3-dihydro-1,4-benzodioxine-6-carbothioamide
نام محصول |
2,3-dihydro-1,4-benzodioxine-6-carbothioamide |
مترادف |
2,3-dihydro-4-Benzodioxin-6-carbothioamide |
میدان مغناطیسی |
C9H9NO2S |
وزن مولکولی |
195.2383 |
InChI |
InChI=1/C9H9NO2S/c10-9(13)6-1-2-7-8(5-6)12-4-3-11-7/h1-2,5H,3-4H2,(H2,10,13) |
شماره سیایاس |
337508-71-1 |
ساختار مولکولی |
|
تراکم |
1.347g/cm3 |
نقطه ذوب |
140.2℃ |
نقطه غلیان |
339.2°C at 760 mmHg |
ضریب شکست |
1.655 |
نقطه اشتعال |
158.9°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|