ChemNet > CAS > 34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
| نام محصول |
dipropylene glycol monomethyl ether, mixture of isomers |
| مترادف |
Di(propylene glycol) methyl ether; Methoxypropoxypropanol; Dipropylene glycol monomethyl ether; DPM |
| میدان مغناطیسی |
C7H16O3 |
| وزن مولکولی |
148.2001 |
| InChI |
InChI=1/C7H16O3/c1-3-7(8)10-6-4-5-9-2/h7-8H,3-6H2,1-2H3 |
| شماره سیایاس |
34590-94-8 |
| تعداد کمیسیون اروپایی |
252-104-2 |
| ساختار مولکولی |
|
| تراکم |
0.958g/cm3 |
| نقطه غلیان |
155.6°C at 760 mmHg |
| ضریب شکست |
1.423 |
| نقطه اشتعال |
47.9°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S23:;
S24/25:;
|
|
