ChemNet > CAS > 35354-29-1 3,5-Diacetoxy Benzoic Acid
35354-29-1 3,5-Diacetoxy Benzoic Acid
| نام محصول |
3,5-Diacetoxy Benzoic Acid |
| مترادف |
3,5-Diacetoxybenzoic acid; 3,5-bis(acetyloxy)benzoic acid |
| میدان مغناطیسی |
C11H10O6 |
| وزن مولکولی |
238.1935 |
| InChI |
InChI=1/C11H10O6/c1-6(12)16-9-3-8(11(14)15)4-10(5-9)17-7(2)13/h3-5H,1-2H3,(H,14,15) |
| شماره سیایاس |
35354-29-1 |
| ساختار مولکولی |
|
| تراکم |
1.344g/cm3 |
| نقطه غلیان |
408.4°C at 760 mmHg |
| ضریب شکست |
1.543 |
| نقطه اشتعال |
160.4°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
