ChemNet > CAS > 368870-06-8 1-(4-chlorophenethyl)-5-oxo-3-pyrrolidinecarboxylic acid
368870-06-8 1-(4-chlorophenethyl)-5-oxo-3-pyrrolidinecarboxylic acid
نام محصول |
1-(4-chlorophenethyl)-5-oxo-3-pyrrolidinecarboxylic acid |
مترادف |
1-[2-(4-chlorophenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid |
میدان مغناطیسی |
C13H14ClNO3 |
وزن مولکولی |
267.7082 |
InChI |
InChI=1/C13H14ClNO3/c14-11-3-1-9(2-4-11)5-6-15-8-10(13(17)18)7-12(15)16/h1-4,10H,5-8H2,(H,17,18) |
شماره سیایاس |
368870-06-8 |
ساختار مولکولی |
|
تراکم |
1.346g/cm3 |
نقطه ذوب |
148℃ |
نقطه غلیان |
496.6°C at 760 mmHg |
ضریب شکست |
1.588 |
نقطه اشتعال |
254.1°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|