ChemNet > CAS > 3857-25-8 5-Methyl-2-furanmethanol
3857-25-8 5-Methyl-2-furanmethanol
نام محصول |
5-Methyl-2-furanmethanol |
مترادف |
(5-Methyl-2-furyl)methanol; (5-methylfuran-2-yl)methanol |
میدان مغناطیسی |
C6H8O2 |
وزن مولکولی |
112.1265 |
InChI |
InChI=1/C6H8O2/c1-5-2-3-6(4-7)8-5/h2-3,7H,4H2,1H3 |
شماره سیایاس |
3857-25-8 |
ساختار مولکولی |
|
تراکم |
1.095g/cm3 |
نقطه غلیان |
178.5°C at 760 mmHg |
ضریب شکست |
1.494 |
نقطه اشتعال |
61.8°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|