4024-14-0 1-Methyl-2-tetralone
نام محصول |
1-Methyl-2-tetralone |
نام انگلیسی |
1-Methyl-2-tetralone; 1,2,3,4-tetrahydro-1-methylnaphthalen-2-one; 1-methyl-3,4-dihydronaphthalen-2(1H)-one; (1S)-1-methyl-3,4-dihydronaphthalen-2(1H)-one; (1R)-1-methyl-3,4-dihydronaphthalen-2(1H)-one |
میدان مغناطیسی |
C11H12O |
وزن مولکولی |
160.2124 |
InChI |
InChI=1/C11H12O/c1-8-10-5-3-2-4-9(10)6-7-11(8)12/h2-5,8H,6-7H2,1H3/t8-/m1/s1 |
شماره سیایاس |
4024-14-0 |
تعداد کمیسیون اروپایی |
223-690-7 |
ساختار مولکولی |
|
تراکم |
1.048g/cm3 |
نقطه غلیان |
261°C at 760 mmHg |
ضریب شکست |
1.539 |
نقطه اشتعال |
114.2°C |
فشار بخار |
0.0118mmHg at 25°C |
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|