نام محصول |
2,4,6-Trimethylphenylacetic acid |
نام انگلیسی |
2,4,6-Trimethylphenylacetic acid; Mesitylacetic acid; Mesityleneacetic acid; Mesity aceti acid; VITAS-BB TBB000369; RARECHEM AL BO 0305; BENZENEACETIC ACID, 2,4,6-TRIMETHYL-; 2,4,6-TRIMETHYLBENZENEACETIC ACID; 2,4,6-TMPAC; 2,4,6-Trimethyl phenylacetic acid; (2,4,6-trimethylphenyl)acetate; 2,4,6-Trimethyphenylacetic acid |
میدان مغناطیسی |
C11H13O2 |
وزن مولکولی |
177.2203 |
InChI |
InChI=1/C11H14O2/c1-7-4-8(2)10(6-11(12)13)9(3)5-7/h4-5H,6H2,1-3H3,(H,12,13)/p-1 |
شماره سیایاس |
4408-60-0 |
تعداد کمیسیون اروپایی |
224-556-0 |
ساختار مولکولی |
|
نقطه ذوب |
167-168℃ |
نقطه غلیان |
312.9°C at 760 mmHg |
نقطه اشتعال |
210°C |
فشار بخار |
0.000219mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|