ChemNet > CAS > 4712-55-4 Diphenyl phosphite
4712-55-4 Diphenyl phosphite
نام محصول |
Diphenyl phosphite |
مترادف |
diphenyl phosphonate; Phosphonic acid diphenyl ester; diphenyl hydrogen phosphite; oxo(diphenoxy)phosphonium |
میدان مغناطیسی |
C12H11O3P |
وزن مولکولی |
234.1877 |
InChI |
InChI=1/C12H11O3P/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,16H |
شماره سیایاس |
4712-55-4 |
تعداد کمیسیون اروپایی |
225-202-8 |
ساختار مولکولی |
|
نقطه ذوب |
12℃ |
نقطه غلیان |
348.233°C at 760 mmHg |
نقطه اشتعال |
178.834°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|