ChemNet > CAS > 5239-82-7 Cyclopropylacetic acid
5239-82-7 Cyclopropylacetic acid
نام محصول |
Cyclopropylacetic acid |
مترادف |
Cyclopropaneacetic acid; N,N'-lambda~4~-sulfanediylidenebis(1,3-dimethyl-1,3,2-diazaborolidin-2-amine); 2-cyclopropylacetic acid |
میدان مغناطیسی |
C8H20B2N6S |
وزن مولکولی |
253.9716 |
InChI |
InChI=1/C8H20B2N6S/c1-13-5-6-14(2)9(13)11-17-12-10-15(3)7-8-16(10)4/h5-8H2,1-4H3 |
شماره سیایاس |
5239-82-7 |
ساختار مولکولی |
|
تراکم |
1.16g/cm3 |
نقطه غلیان |
293°C at 760 mmHg |
ضریب شکست |
1.584 |
نقطه اشتعال |
131°C |
خطر نمادها |
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|