ChemNet > CAS > 5721-12-0 اتیل 2.6-diaminohexanoate دی هیدروکلراید؛ اتیل DL-lysinate دی هیدروکلراید؛ اتیل DL-lysinate HCl
5721-12-0 اتیل 2.6-diaminohexanoate دی هیدروکلراید؛ اتیل DL-lysinate دی هیدروکلراید؛ اتیل DL-lysinate HCl
| نام محصول |
اتیل 2.6-diaminohexanoate دی هیدروکلراید؛ اتیل DL-lysinate دی هیدروکلراید؛ اتیل DL-lysinate HCl |
| نام انگلیسی |
ethyl 2,6-diaminohexanoate dihydrochloride;Ethyl DL-lysinate dihydrochloride; Ethyl DL-lysinate HCl |
| میدان مغناطیسی |
C8H20Cl2N2O2 |
| وزن مولکولی |
247.16
|
| InChI |
InChI=1/C8H18N2O2.2ClH/c1-2-12-8(11)7(10)5-3-4-6-9;;/h7H,2-6,9-10H2,1H3;2*1H |
| شماره سیایاس |
5721-12-0 |
| تعداد کمیسیون اروپایی |
227-224-3 |
| ساختار مولکولی |
|
| خطر نمادها |
Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|