ChemNet > CAS > 6484-25-9 4-Chloro-2-phenylquinazoline
6484-25-9 4-Chloro-2-phenylquinazoline
نام محصول |
4-Chloro-2-phenylquinazoline |
مترادف |
AM-ex-OL |
میدان مغناطیسی |
C14H9ClN2 |
وزن مولکولی |
240.6877 |
InChI |
InChI=1/C14H9ClN2/c15-13-11-8-4-5-9-12(11)16-14(17-13)10-6-2-1-3-7-10/h1-9H |
شماره سیایاس |
6484-25-9 |
تعداد کمیسیون اروپایی |
229-346-2 |
ساختار مولکولی |
|
تراکم |
1.285g/cm3 |
نقطه ذوب |
123-128℃ |
نقطه غلیان |
301.2°C at 760 mmHg |
ضریب شکست |
1.667 |
نقطه اشتعال |
164.4°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|