ChemNet > CAS > 68065-81-6 trans-4-Cyano-4'-(4-n-pentylcyclohexyl)biphenyl
68065-81-6 trans-4-Cyano-4'-(4-n-pentylcyclohexyl)biphenyl
نام محصول |
trans-4-Cyano-4'-(4-n-pentylcyclohexyl)biphenyl |
مترادف |
trans-4-(4-n-Pentylcyclohexyl)-4-biphenylcarbonitrile; 4-(trans-4-Pentylcyclohexyl)-4-cyanobiphenyl; 4'-(4-pentylcyclohexyl)biphenyl-4-carbonitrile; Trans-4-Cyano-4-(4-n-Pentylcyclohexyl)Biphenyl; 4-(Trans-4-Pentylcyclohexyl)Biphenylnitrile; trans-4'-(4-pentylcyclohexyl)-4-biphenyl carbonitrile |
میدان مغناطیسی |
C24H29N |
وزن مولکولی |
331.4938 |
InChI |
InChI=1/C24H29N/c1-2-3-4-5-19-6-10-21(11-7-19)23-14-16-24(17-15-23)22-12-8-20(18-25)9-13-22/h8-9,12-17,19,21H,2-7,10-11H2,1H3 |
شماره سیایاس |
68065-81-6 |
تعداد کمیسیون اروپایی |
268-333-6 |
ساختار مولکولی |
|
تراکم |
1.03g/cm3 |
نقطه غلیان |
479.2°C at 760 mmHg |
ضریب شکست |
1.566 |
نقطه اشتعال |
245.5°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|