6843-66-9 Diphenyldimethoxysilane
| نام محصول |
Diphenyldimethoxysilane |
| نام انگلیسی |
Diphenyldimethoxysilane; Dimethoxydiphenylsilane; Diphenyl dimethoxylsilicane |
| میدان مغناطیسی |
C14H18O2Si |
| وزن مولکولی |
246.377 |
| InChI |
InChI=1/C12H10.C2H8O2Si/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-5-4-2/h1-10H;5H2,1-2H3 |
| شماره سیایاس |
6843-66-9 |
| تعداد کمیسیون اروپایی |
229-929-1 |
| ساختار مولکولی |
|
| خطر نمادها |
Xi:Irritant;
|
| کدهای خطر |
R38:;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|