733-07-3 dimesitylmethane
نام محصول |
dimesitylmethane |
نام انگلیسی |
dimesitylmethane; Bis(2,4,6-trimethylphenyl)methane~2,2-Methylenedimesitylene; 1,1-Methylenebis-(2,4,6-trimethylbenzene); 1,1'-methanediylbis(2,4,6-trimethylbenzene) |
میدان مغناطیسی |
C19H24 |
وزن مولکولی |
252.3939 |
InChI |
InChI=1/C19H24/c1-12-7-14(3)18(15(4)8-12)11-19-16(5)9-13(2)10-17(19)6/h7-10H,11H2,1-6H3 |
شماره سیایاس |
733-07-3 |
تعداد کمیسیون اروپایی |
211-991-6 |
ساختار مولکولی |
|
تراکم |
0.947g/cm3 |
نقطه ذوب |
132-135℃ |
نقطه غلیان |
370.7°C at 760 mmHg |
ضریب شکست |
1.547 |
نقطه اشتعال |
192.8°C |
فشار بخار |
2.31E-05mmHg at 25°C |
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|