ChemNet > CAS > 868-54-2 2-Amino-1-propene-1,1,3-tricarbonitrile
868-54-2 2-Amino-1-propene-1,1,3-tricarbonitrile
نام محصول |
2-Amino-1-propene-1,1,3-tricarbonitrile |
مترادف |
2-aminoprop-1-ene-1,1,3-tricarbonitrile |
میدان مغناطیسی |
C6H4N4 |
وزن مولکولی |
132.1228 |
InChI |
InChI=1/C6H4N4/c7-2-1-6(10)5(3-8)4-9/h5,10H,1H2/b10-6+ |
شماره سیایاس |
868-54-2 |
تعداد کمیسیون اروپایی |
212-777-5 |
ساختار مولکولی |
|
تراکم |
1.13g/cm3 |
نقطه ذوب |
171-173℃ |
نقطه غلیان |
454.9°C at 760 mmHg |
ضریب شکست |
1.565 |
نقطه اشتعال |
228.9°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|