ChemNet > CAS > 90002-36-1 2-Ethylbenzeneboronic acid
90002-36-1 2-Ethylbenzeneboronic acid
نام محصول |
2-Ethylbenzeneboronic acid |
مترادف |
2-Ethylphenylboronic acid; RNase A |
میدان مغناطیسی |
C8H11BO2 |
وزن مولکولی |
149.9827 |
InChI |
InChI=1/C8H11BO2/c1-2-7-5-3-4-6-8(7)9(10)11/h3-6,10-11H,2H2,1H3 |
شماره سیایاس |
90002-36-1 |
ساختار مولکولی |
|
تراکم |
1.07g/cm3 |
نقطه ذوب |
102.5-107.5℃ |
نقطه غلیان |
299.1°C at 760 mmHg |
ضریب شکست |
1.521 |
نقطه اشتعال |
134.7°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|