ChemNet > CAS > 90002-36-1 2-Ethylbenzeneboronic acid
90002-36-1 2-Ethylbenzeneboronic acid
| نام محصول |
2-Ethylbenzeneboronic acid |
| مترادف |
2-Ethylphenylboronic acid; RNase A |
| میدان مغناطیسی |
C8H11BO2 |
| وزن مولکولی |
149.9827 |
| InChI |
InChI=1/C8H11BO2/c1-2-7-5-3-4-6-8(7)9(10)11/h3-6,10-11H,2H2,1H3 |
| شماره سیایاس |
90002-36-1 |
| ساختار مولکولی |
|
| تراکم |
1.07g/cm3 |
| نقطه ذوب |
102.5-107.5℃ |
| نقطه غلیان |
299.1°C at 760 mmHg |
| ضریب شکست |
1.521 |
| نقطه اشتعال |
134.7°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
