ChemNet > CAS > 93-72-1 2-(2,4,5-Trichlorophenoxy)propionic acid
93-72-1 2-(2,4,5-Trichlorophenoxy)propionic acid
| نام محصول |
2-(2,4,5-Trichlorophenoxy)propionic acid |
| مترادف |
Silvex; tube; Fenoprop~Silvex; (2R)-2-(2,4,5-trichlorophenoxy)propanoic acid; (2S)-2-(2,4,5-trichlorophenoxy)propanoate; (2R)-2-(2,4,5-trichlorophenoxy)propanoate |
| میدان مغناطیسی |
C9H6Cl3O3 |
| وزن مولکولی |
268.5017 |
| InChI |
InChI=1/C9H7Cl3O3/c1-4(9(13)14)15-8-3-6(11)5(10)2-7(8)12/h2-4H,1H3,(H,13,14)/p-1/t4-/m1/s1 |
| شماره سیایاس |
93-72-1 |
| تعداد کمیسیون اروپایی |
202-271-2 |
| ساختار مولکولی |
|
| نقطه ذوب |
177-181℃ |
| نقطه غلیان |
378.4°C at 760 mmHg |
| نقطه اشتعال |
182.6°C |
| خطر نمادها |
 Xn:Harmful;
 N:Dangerous for the environment;
|
| کدهای خطر |
R22:Harmful if swallowed.;
R38:Irritating to skin.;
R50/53:Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| توضیحات ایمنی |
S37:Wear suitable gloves.;
S60:This material and its container must be disposed of as hazardous waste.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
