ChemNet > CAS > 10534-89-1 Hexaaminecobalt(III) chloride
10534-89-1 Hexaaminecobalt(III) chloride
| Nome del prodotto |
Hexaaminecobalt(III) chloride |
| Nome inglese |
Hexaaminecobalt(III) chloride; Hexaamine cobalt(III) chloride; hexamminecobalttrichloride; Hexaamminecobalt (III) chloride; Hexamminecobalt(III) chloride; hexaamminecobalt trichloride; Hexaamminecobaltchlorideorangepowder; cobalt(3+) chloride ammoniate (1:3:6); azanide; cobalt |
| Formula molecolare |
C6H12ClCoN4 |
| Peso Molecolare |
234.5719 |
| InChI |
InChI=1/C6H12N4.ClH.Co/c1-7-2-9-4-8(1)5-10(3-7)6-9;;/h1-6H2;1H;/q;;+2/p-1 |
| Numero CAS |
10534-89-1 |
| EINECS |
234-103-9 |
| Struttura molecolare |
|
| Punto di fusione |
217℃ |
| Simboli di pericolo |
Xn:Harmful;
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S36/37:Wear suitable protective clothing and gloves.;
|
|