ChemNet > CAS > 120-61-6 Dimethyl terephthalate
120-61-6 Dimethyl terephthalate
| Nome del prodotto |
Dimethyl terephthalate |
| Sinonimi |
D.M.T.; Terephthalic acid dimethyl ester; Benzene-1,4-dicarboxylic acid dimethyl ester; Terephthalic acid dimethyl ester; dimethyl cyclohexane-1,4-dicarboxylate; 1,3-benzodioxol-5-yl methylcarbamate; dimethyl benzene-1,4-dicarboxylate; 4-(methoxycarbonyl)benzoic acid; dimethyl benzene-1,2-dicarboxylate; DMT |
| Formula molecolare |
C10H10O4 |
| Peso Molecolare |
194.184 |
| InChI |
InChI=1/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3 |
| Numero CAS |
120-61-6 |
| EINECS |
204-411-8 |
| Struttura molecolare |
|
| Densità |
1.175g/cm3 |
| Punto di fusione |
140-143℃ |
| Punto di ebollizione |
282.7°C at 760 mmHg |
| Indice di rifrazione |
1.514 |
| Punto d'infiammabilità |
146.7°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
