1287-16-7 Ferrocenylacetic acid
| Nome del prodotto |
Ferrocenylacetic acid |
| Nome inglese |
Ferrocenylacetic acid; Ferroceneacetic acid; Carboxymethylferrocene; Ferrocenyl Acetic Acid; Ferrocenfethanol; 1,2,3,4,5-cyclopentanepentayl, 1-(carboxymethyl)-, compd. with 1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1) |
| Formula molecolare |
C12H12FeO2 |
| Peso Molecolare |
244.0675 |
| InChI |
InChI=1/C7H7O2.C5H5.Fe/c8-7(9)5-6-3-1-2-4-6;1-2-4-5-3-1;/h1-4H,5H2,(H,8,9);1-5H; |
| Numero CAS |
1287-16-7 |
| Struttura molecolare |
|
| Punto di fusione |
158-160℃ |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|