ChemNet > CAS > 139911-27-6 4-Fluoro-3-methylbenzeneboronic acid
139911-27-6 4-Fluoro-3-methylbenzeneboronic acid
| Nome del prodotto |
4-Fluoro-3-methylbenzeneboronic acid |
| Sinonimi |
4-Fluoro-3-methylphenylboronic acid; 4-Fluoro-m-tolylboronic acid |
| Formula molecolare |
C7H8BFO2 |
| Peso Molecolare |
153.9466 |
| InChI |
InChI=1/C7H8BFO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4,10-11H,1H3 |
| Numero CAS |
139911-27-6 |
| Struttura molecolare |
|
| Densità |
1.2g/cm3 |
| Punto di fusione |
212-217℃ |
| Punto di ebollizione |
282°C at 760 mmHg |
| Indice di rifrazione |
1.505 |
| Punto d'infiammabilità |
124.3°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
