ChemNet > CAS > 1422-54-4 2-Bromo-6-fluorotoluene
1422-54-4 2-Bromo-6-fluorotoluene
| Nome del prodotto |
2-Bromo-6-fluorotoluene |
| Sinonimi |
Bromofluorotoluene3; 5-chloro-6-fluoro-1,3-dihydro-2H-benzimidazole-2-thione |
| Formula molecolare |
C7H4ClFN2S |
| Peso Molecolare |
202.6365 |
| InChI |
InChI=1/C7H4ClFN2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,(H2,10,11,12) |
| Numero CAS |
1422-54-4 |
| Struttura molecolare |
|
| Densità |
1.63g/cm3 |
| Punto di ebollizione |
294°C at 760 mmHg |
| Indice di rifrazione |
1.714 |
| Punto d'infiammabilità |
131.6°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
